C10H12N2O2 — CID 130980249
(7-ethoxy-1,3-benzoxazol-2-yl)methanamine (PubChem CID 130980249) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is (7-ethoxy-1,3-benzoxazol-2-yl)methanamine.
| Compound Name | (7-ethoxy-1,3-benzoxazol-2-yl)methanamine |
|---|---|
| PubChem CID | 130980249 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (7-ethoxy-1,3-benzoxazol-2-yl)methanamine |
| SMILES | CCOc1cccc2nc(CN)oc12 |
| InChI | InChI=1S/C10H12N2O2/c1-2-13-8-5-3-4-7-10(8)14-9(6-11)12-7/h3-5H,2,6,11H2,1H3 |
| InChIKey | NCTMROHYVJYKMH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |