About 1,9-diethoxyphenazine
1,9-diethoxyphenazine (PubChem CID 71668489) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is 1,9-diethoxyphenazine.
Molecular Properties
| Compound Name | 1,9-diethoxyphenazine |
| PubChem CID | 71668489 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1,9-diethoxyphenazine |
| SMILES | CCOc1cccc2nc3cccc(OCC)c3nc12 |
| InChI | InChI=1S/C16H16N2O2/c1-3-19-13-9-5-7-11-15(13)18-16-12(17-11)8-6-10-14(16)20-4-2/h5-10H,3-4H2,1-2H3 |
| InChIKey | JDIGRVOCFDOHSV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,9-diethoxyphenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,9-diethoxyphenazine?
The IUPAC name of 1,9-diethoxyphenazine (CID 71668489) is 1,9-diethoxyphenazine.
What is the SMILES notation for 1,9-diethoxyphenazine?
The canonical SMILES for 1,9-diethoxyphenazine is CCOc1cccc2nc3cccc(OCC)c3nc12.
What is the InChIKey of 1,9-diethoxyphenazine?
The InChIKey is JDIGRVOCFDOHSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2/c1-3-19-13-9-5-7-11-15(13)18-16-12(17-11)8-6-10-14(16)20-4-2/h5-10H,3-4H2,1-2H3.
What are the key properties of 1,9-diethoxyphenazine?
1,9-diethoxyphenazine has a molecular weight of 268.32 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,9-diethoxyphenazine is sourced from PubChem (CID 71668489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).