C11H15NO2 — CID 159856269
ethane;4-ethoxy-1,3-benzoxazole (PubChem CID 159856269) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is ethane;4-ethoxy-1,3-benzoxazole.
| Compound Name | ethane;4-ethoxy-1,3-benzoxazole |
|---|---|
| PubChem CID | 159856269 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethane;4-ethoxy-1,3-benzoxazole |
| SMILES | CC.CCOc1cccc2ocnc12 |
| InChI | InChI=1S/C9H9NO2.C2H6/c1-2-11-7-4-3-5-8-9(7)10-6-12-8;1-2/h3-6H,2H2,1H3;1-2H3 |
| InChIKey | NQOLKJPZIIKFMP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |