C12H16O4 — CID 19833387
(2,3-diethoxyphenyl) acetate (PubChem CID 19833387) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (2,3-diethoxyphenyl) acetate.
| Compound Name | (2,3-diethoxyphenyl) acetate |
|---|---|
| PubChem CID | 19833387 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (2,3-diethoxyphenyl) acetate |
| SMILES | CCOc1cccc(OC(C)=O)c1OCC |
| InChI | InChI=1S/C12H16O4/c1-4-14-10-7-6-8-11(16-9(3)13)12(10)15-5-2/h6-8H,4-5H2,1-3H3 |
| InChIKey | TZINJDCZLXCLJD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|