About (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate
(3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate (PubChem CID 90032322) has the molecular formula C27H34O10
and a molecular weight of 518.56 g/mol. Its IUPAC name is (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate.
Molecular Properties
| Compound Name | (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate |
| PubChem CID | 90032322 |
| Molecular Formula | C27H34O10 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate |
| SMILES | CCC(=O)Oc1cccc(OC)c1OC(=O)CC.CCOc1cccc(OC(=O)CC)c1OC(=O)CC |
| InChI | InChI=1S/C14H18O5.C13H16O5/c1-4-12(15)18-11-9-7-8-10(17-6-3)14(11)19-13(16)5-2;1-4-11(14)17-10-8-6-7-9(16-3)13(10)18-12(15)5-2/h7-9H,4-6H2,1-3H3;6-8H,4-5H2,1-3H3 |
| InChIKey | BTSQURSQBGJQAM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate?
The IUPAC name of (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate (CID 90032322) is (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate.
What is the SMILES notation for (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate?
The canonical SMILES for (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate is CCC(=O)Oc1cccc(OC)c1OC(=O)CC.CCOc1cccc(OC(=O)CC)c1OC(=O)CC.
What is the InChIKey of (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate?
The InChIKey is BTSQURSQBGJQAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5.C13H16O5/c1-4-12(15)18-11-9-7-8-10(17-6-3)14(11)19-13(16)5-2;1-4-11(14)17-10-8-6-7-9(16-3)13(10)18-12(15)5-2/h7-9H,4-6H2,1-3H3;6-8H,4-5H2,1-3H3.
What are the key properties of (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate?
(3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate has a molecular weight of 518.56 g/mol, XLogP of 5.04, 11 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxy-2-propanoyloxyphenyl) propanoate;(3-methoxy-2-propanoyloxyphenyl) propanoate is sourced from PubChem (CID 90032322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).