C22H28O6 — CID 145114248
1,1-bis(2,3-dimethoxyphenyl)propan-2-yl propanoate (PubChem CID 145114248) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is 1,1-bis(2,3-dimethoxyphenyl)propan-2-yl propanoate.
| Compound Name | 1,1-bis(2,3-dimethoxyphenyl)propan-2-yl propanoate |
|---|---|
| PubChem CID | 145114248 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1,1-bis(2,3-dimethoxyphenyl)propan-2-yl propanoate |
| SMILES | CCC(=O)OC(C)C(c1cccc(OC)c1OC)c1cccc(OC)c1OC |
| InChI | InChI=1S/C22H28O6/c1-7-19(23)28-14(2)20(15-10-8-12-17(24-3)21(15)26-5)16-11-9-13-18(25-4)22(16)27-6/h8-14,20H,7H2,1-6H3 |
| InChIKey | UWLRAWBZCCXKGG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |