About 3,8-diethoxyquinoline
3,8-diethoxyquinoline (PubChem CID 45094466) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 3,8-diethoxyquinoline.
Molecular Properties
| Compound Name | 3,8-diethoxyquinoline |
| PubChem CID | 45094466 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3,8-diethoxyquinoline |
| SMILES | CCOc1cnc2c(OCC)cccc2c1 |
| InChI | InChI=1S/C13H15NO2/c1-3-15-11-8-10-6-5-7-12(16-4-2)13(10)14-9-11/h5-9H,3-4H2,1-2H3 |
| InChIKey | LDCLCDZRWOXUFA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,8-diethoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-diethoxyquinoline?
The IUPAC name of 3,8-diethoxyquinoline (CID 45094466) is 3,8-diethoxyquinoline.
What is the SMILES notation for 3,8-diethoxyquinoline?
The canonical SMILES for 3,8-diethoxyquinoline is CCOc1cnc2c(OCC)cccc2c1.
What is the InChIKey of 3,8-diethoxyquinoline?
The InChIKey is LDCLCDZRWOXUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-3-15-11-8-10-6-5-7-12(16-4-2)13(10)14-9-11/h5-9H,3-4H2,1-2H3.
What are the key properties of 3,8-diethoxyquinoline?
3,8-diethoxyquinoline has a molecular weight of 217.27 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-diethoxyquinoline is sourced from PubChem (CID 45094466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).