C9H10N2O2 — CID 146278299
4-ethoxy-2,1-benzoxazol-3-amine (PubChem CID 146278299) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-ethoxy-2,1-benzoxazol-3-amine.
| Compound Name | 4-ethoxy-2,1-benzoxazol-3-amine |
|---|---|
| PubChem CID | 146278299 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4-ethoxy-2,1-benzoxazol-3-amine |
| SMILES | CCOc1cccc2noc(N)c12 |
| InChI | InChI=1S/C9H10N2O2/c1-2-12-7-5-3-4-6-8(7)9(10)13-11-6/h3-5H,2,10H2,1H3 |
| InChIKey | RCGXYKLPDFAJLT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |