C17H17N3O2 — CID 19330739
3-[5-(2-ethoxyphenyl)-1,2,4-oxadiazol-3-yl]-2-methylaniline (PubChem CID 19330739) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-[5-(2-ethoxyphenyl)-1,2,4-oxadiazol-3-yl]-2-methylaniline.
| Compound Name | 3-[5-(2-ethoxyphenyl)-1,2,4-oxadiazol-3-yl]-2-methylaniline |
|---|---|
| PubChem CID | 19330739 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 3-[5-(2-ethoxyphenyl)-1,2,4-oxadiazol-3-yl]-2-methylaniline |
| SMILES | CCOc1ccccc1-c1nc(-c2cccc(N)c2C)no1 |
| InChI | InChI=1S/C17H17N3O2/c1-3-21-15-10-5-4-7-13(15)17-19-16(20-22-17)12-8-6-9-14(18)11(12)2/h4-10H,3,18H2,1-2H3 |
| InChIKey | GCNZPHXBKSTZOF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|