C14H13N3O2S — CID 115533010
2-[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-amine (PubChem CID 115533010) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-amine.
| Compound Name | 2-[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-amine |
|---|---|
| PubChem CID | 115533010 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]thiophen-3-amine |
| SMILES | CCOc1ccccc1-c1noc(-c2sccc2N)n1 |
| InChI | InChI=1S/C14H13N3O2S/c1-2-18-11-6-4-3-5-9(11)13-16-14(19-17-13)12-10(15)7-8-20-12/h3-8H,2,15H2,1H3 |
| InChIKey | IOLHISHOJWSMPD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |