C12H12N2O3 — CID 115534402
1-[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanone (PubChem CID 115534402) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanone.
| Compound Name | 1-[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 115534402 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-[3-(2-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanone |
| SMILES | CCOc1ccccc1-c1noc(C(C)=O)n1 |
| InChI | InChI=1S/C12H12N2O3/c1-3-16-10-7-5-4-6-9(10)11-13-12(8(2)15)17-14-11/h4-7H,3H2,1-2H3 |
| InChIKey | GBJMWIXDYMGESQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |