C13H13N3OS — CID 83163271
4-(4-ethoxy-1H-indol-3-yl)-1,3-thiazol-2-amine (PubChem CID 83163271) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 4-(4-ethoxy-1H-indol-3-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-ethoxy-1H-indol-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 83163271 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-(4-ethoxy-1H-indol-3-yl)-1,3-thiazol-2-amine |
| SMILES | CCOc1cccc2[nH]cc(-c3csc(N)n3)c12 |
| InChI | InChI=1S/C13H13N3OS/c1-2-17-11-5-3-4-9-12(11)8(6-15-9)10-7-18-13(14)16-10/h3-7,15H,2H2,1H3,(H2,14,16) |
| InChIKey | CWTFMOUWAQCCEA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |