C13H18N2O — CID 83917405
3-(4-ethoxy-1H-indol-3-yl)propan-1-amine (PubChem CID 83917405) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-(4-ethoxy-1H-indol-3-yl)propan-1-amine.
| Compound Name | 3-(4-ethoxy-1H-indol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 83917405 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3-(4-ethoxy-1H-indol-3-yl)propan-1-amine |
| SMILES | CCOc1cccc2[nH]cc(CCCN)c12 |
| InChI | InChI=1S/C13H18N2O/c1-2-16-12-7-3-6-11-13(12)10(9-15-11)5-4-8-14/h3,6-7,9,15H,2,4-5,8,14H2,1H3 |
| InChIKey | PHUJBZHBUJRMPB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |