C9H9NO2 — CID 119091546
4-methoxy-3-methyl-2,1-benzoxazole (PubChem CID 119091546) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 4-methoxy-3-methyl-2,1-benzoxazole.
| Compound Name | 4-methoxy-3-methyl-2,1-benzoxazole |
|---|---|
| PubChem CID | 119091546 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 4-methoxy-3-methyl-2,1-benzoxazole |
| SMILES | COc1cccc2noc(C)c12 |
| InChI | InChI=1S/C9H9NO2/c1-6-9-7(10-12-6)4-3-5-8(9)11-2/h3-5H,1-2H3 |
| InChIKey | DNTCWZLVQWATDN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |