About 4-methoxyquinolin-5-ol
4-methoxyquinolin-5-ol (PubChem CID 137240019) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 4-methoxyquinolin-5-ol.
Molecular Properties
| Compound Name | 4-methoxyquinolin-5-ol |
| PubChem CID | 137240019 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 4-methoxyquinolin-5-ol |
| SMILES | COc1ccnc2cccc(O)c12 |
| InChI | InChI=1S/C10H9NO2/c1-13-9-5-6-11-7-3-2-4-8(12)10(7)9/h2-6,12H,1H3 |
| InChIKey | FODXYRRMFQKAPD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxyquinolin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxyquinolin-5-ol?
The IUPAC name of 4-methoxyquinolin-5-ol (CID 137240019) is 4-methoxyquinolin-5-ol.
What is the SMILES notation for 4-methoxyquinolin-5-ol?
The canonical SMILES for 4-methoxyquinolin-5-ol is COc1ccnc2cccc(O)c12.
What is the InChIKey of 4-methoxyquinolin-5-ol?
The InChIKey is FODXYRRMFQKAPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c1-13-9-5-6-11-7-3-2-4-8(12)10(7)9/h2-6,12H,1H3.
What are the key properties of 4-methoxyquinolin-5-ol?
4-methoxyquinolin-5-ol has a molecular weight of 175.19 g/mol, XLogP of 1.95, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxyquinolin-5-ol is sourced from PubChem (CID 137240019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).