About 2-ethoxyaniline;molecular hydrogen
2-ethoxyaniline;molecular hydrogen (PubChem CID 144877970) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-ethoxyaniline;molecular hydrogen.
Molecular Properties
| Compound Name | 2-ethoxyaniline;molecular hydrogen |
| PubChem CID | 144877970 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 2-ethoxyaniline;molecular hydrogen |
| SMILES | CCOc1ccccc1N.[H][H] |
| InChI | InChI=1S/C8H11NO.H2/c1-2-10-8-6-4-3-5-7(8)9;/h3-6H,2,9H2,1H3;1H |
| InChIKey | OOTXEPFETGDIPR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyaniline;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyaniline;molecular hydrogen?
The IUPAC name of 2-ethoxyaniline;molecular hydrogen (CID 144877970) is 2-ethoxyaniline;molecular hydrogen.
What is the SMILES notation for 2-ethoxyaniline;molecular hydrogen?
The canonical SMILES for 2-ethoxyaniline;molecular hydrogen is CCOc1ccccc1N.[H][H].
What is the InChIKey of 2-ethoxyaniline;molecular hydrogen?
The InChIKey is OOTXEPFETGDIPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.H2/c1-2-10-8-6-4-3-5-7(8)9;/h3-6H,2,9H2,1H3;1H.
What are the key properties of 2-ethoxyaniline;molecular hydrogen?
2-ethoxyaniline;molecular hydrogen has a molecular weight of 139.20 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyaniline;molecular hydrogen is sourced from PubChem (CID 144877970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).