About (2-aminophenoxy)methanol
(2-aminophenoxy)methanol (PubChem CID 22976615) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is (2-aminophenoxy)methanol.
Molecular Properties
| Compound Name | (2-aminophenoxy)methanol |
| PubChem CID | 22976615 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (2-aminophenoxy)methanol |
| SMILES | Nc1ccccc1OCO |
| InChI | InChI=1S/C7H9NO2/c8-6-3-1-2-4-7(6)10-5-9/h1-4,9H,5,8H2 |
| InChIKey | MPIVDFUAQVKULL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-aminophenoxy)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminophenoxy)methanol?
The IUPAC name of (2-aminophenoxy)methanol (CID 22976615) is (2-aminophenoxy)methanol.
What is the SMILES notation for (2-aminophenoxy)methanol?
The canonical SMILES for (2-aminophenoxy)methanol is Nc1ccccc1OCO.
What is the InChIKey of (2-aminophenoxy)methanol?
The InChIKey is MPIVDFUAQVKULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c8-6-3-1-2-4-7(6)10-5-9/h1-4,9H,5,8H2.
What are the key properties of (2-aminophenoxy)methanol?
(2-aminophenoxy)methanol has a molecular weight of 139.15 g/mol, XLogP of 0.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminophenoxy)methanol is sourced from PubChem (CID 22976615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).