About 2-ethoxyaniline;propan-2-one
2-ethoxyaniline;propan-2-one (PubChem CID 517004) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-ethoxyaniline;propan-2-one.
Molecular Properties
| Compound Name | 2-ethoxyaniline;propan-2-one |
| PubChem CID | 517004 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-ethoxyaniline;propan-2-one |
| SMILES | CC(C)=O.CCOc1ccccc1N |
| InChI | InChI=1S/C8H11NO.C3H6O/c1-2-10-8-6-4-3-5-7(8)9;1-3(2)4/h3-6H,2,9H2,1H3;1-2H3 |
| InChIKey | WRNMZLSLAABCMS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyaniline;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyaniline;propan-2-one?
The IUPAC name of 2-ethoxyaniline;propan-2-one (CID 517004) is 2-ethoxyaniline;propan-2-one.
What is the SMILES notation for 2-ethoxyaniline;propan-2-one?
The canonical SMILES for 2-ethoxyaniline;propan-2-one is CC(C)=O.CCOc1ccccc1N.
What is the InChIKey of 2-ethoxyaniline;propan-2-one?
The InChIKey is WRNMZLSLAABCMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C3H6O/c1-2-10-8-6-4-3-5-7(8)9;1-3(2)4/h3-6H,2,9H2,1H3;1-2H3.
What are the key properties of 2-ethoxyaniline;propan-2-one?
2-ethoxyaniline;propan-2-one has a molecular weight of 195.26 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyaniline;propan-2-one is sourced from PubChem (CID 517004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).