C13H18N2O — CID 82230825
3-(7-propan-2-yl-1,3-benzoxazol-2-yl)propan-1-amine (PubChem CID 82230825) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-(7-propan-2-yl-1,3-benzoxazol-2-yl)propan-1-amine.
| Compound Name | 3-(7-propan-2-yl-1,3-benzoxazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 82230825 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3-(7-propan-2-yl-1,3-benzoxazol-2-yl)propan-1-amine |
| SMILES | CC(C)c1cccc2nc(CCCN)oc12 |
| InChI | InChI=1S/C13H18N2O/c1-9(2)10-5-3-6-11-13(10)16-12(15-11)7-4-8-14/h3,5-6,9H,4,7-8,14H2,1-2H3 |
| InChIKey | XNBICJHJIADXSD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |