C9H7F2NO2 — CID 131092416
[7-(difluoromethyl)-1,3-benzoxazol-2-yl]methanol (PubChem CID 131092416) has the molecular formula C9H7F2NO2 and a molecular weight of 199.16 g/mol. Its IUPAC name is [7-(difluoromethyl)-1,3-benzoxazol-2-yl]methanol.
| Compound Name | [7-(difluoromethyl)-1,3-benzoxazol-2-yl]methanol |
|---|---|
| PubChem CID | 131092416 |
| Molecular Formula | C9H7F2NO2 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | [7-(difluoromethyl)-1,3-benzoxazol-2-yl]methanol |
| SMILES | OCc1nc2cccc(C(F)F)c2o1 |
| InChI | InChI=1S/C9H7F2NO2/c10-9(11)5-2-1-3-6-8(5)14-7(4-13)12-6/h1-3,9,13H,4H2 |
| InChIKey | LQMQDFHUGHWRKA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |