C8H6INO2 — CID 131052024
(7-iodo-1,3-benzoxazol-2-yl)methanol (PubChem CID 131052024) has the molecular formula C8H6INO2 and a molecular weight of 275.04 g/mol. Its IUPAC name is (7-iodo-1,3-benzoxazol-2-yl)methanol.
| Compound Name | (7-iodo-1,3-benzoxazol-2-yl)methanol |
|---|---|
| PubChem CID | 131052024 |
| Molecular Formula | C8H6INO2 |
| Molecular Weight | 275.04 g/mol |
| Exact Mass | 274.94 |
| IUPAC Name | (7-iodo-1,3-benzoxazol-2-yl)methanol |
| SMILES | OCc1nc2cccc(I)c2o1 |
| InChI | InChI=1S/C8H6INO2/c9-5-2-1-3-6-8(5)12-7(4-11)10-6/h1-3,11H,4H2 |
| InChIKey | KUCYOVSCUKJVIJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.04 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|