C8H6ClNO2 — CID 130132807
(7-chloro-1,3-benzoxazol-2-yl)methanol (PubChem CID 130132807) has the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. Its IUPAC name is (7-chloro-1,3-benzoxazol-2-yl)methanol.
| Compound Name | (7-chloro-1,3-benzoxazol-2-yl)methanol |
|---|---|
| PubChem CID | 130132807 |
| Molecular Formula | C8H6ClNO2 |
| Molecular Weight | 183.59 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | (7-chloro-1,3-benzoxazol-2-yl)methanol |
| SMILES | OCc1nc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C8H6ClNO2/c9-5-2-1-3-6-8(5)12-7(4-11)10-6/h1-3,11H,4H2 |
| InChIKey | TXPMHQYPRFVGNO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.59 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |