C11H13ClN2O2 — CID 81432937
N-[(7-chloro-1,3-benzoxazol-2-yl)methyl]-2-methoxyethanamine (PubChem CID 81432937) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is N-[(7-chloro-1,3-benzoxazol-2-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(7-chloro-1,3-benzoxazol-2-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 81432937 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | N-[(7-chloro-1,3-benzoxazol-2-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1nc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C11H13ClN2O2/c1-15-6-5-13-7-10-14-9-4-2-3-8(12)11(9)16-10/h2-4,13H,5-7H2,1H3 |
| InChIKey | STMYHCNZAZXIFT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|