C9H7F2NO3 — CID 131625826
[5-(difluoromethoxy)-1,3-benzoxazol-2-yl]methanol (PubChem CID 131625826) has the molecular formula C9H7F2NO3 and a molecular weight of 215.16 g/mol. Its IUPAC name is [5-(difluoromethoxy)-1,3-benzoxazol-2-yl]methanol.
| Compound Name | [5-(difluoromethoxy)-1,3-benzoxazol-2-yl]methanol |
|---|---|
| PubChem CID | 131625826 |
| Molecular Formula | C9H7F2NO3 |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | [5-(difluoromethoxy)-1,3-benzoxazol-2-yl]methanol |
| SMILES | OCc1nc2cc(OC(F)F)ccc2o1 |
| InChI | InChI=1S/C9H7F2NO3/c10-9(11)14-5-1-2-7-6(3-5)12-8(4-13)15-7/h1-3,9,13H,4H2 |
| InChIKey | OTTFEBZRBQWAOQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |