C10H5BrF3NO3 — CID 170837803
2-bromo-1-[5-(trifluoromethoxy)-1,3-benzoxazol-2-yl]ethanone (PubChem CID 170837803) has the molecular formula C10H5BrF3NO3 and a molecular weight of 324.05 g/mol. Its IUPAC name is 2-bromo-1-[5-(trifluoromethoxy)-1,3-benzoxazol-2-yl]ethanone.
| Compound Name | 2-bromo-1-[5-(trifluoromethoxy)-1,3-benzoxazol-2-yl]ethanone |
|---|---|
| PubChem CID | 170837803 |
| Molecular Formula | C10H5BrF3NO3 |
| Molecular Weight | 324.05 g/mol |
| Exact Mass | 322.94 |
| IUPAC Name | 2-bromo-1-[5-(trifluoromethoxy)-1,3-benzoxazol-2-yl]ethanone |
| SMILES | O=C(CBr)c1nc2cc(OC(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C10H5BrF3NO3/c11-4-7(16)9-15-6-3-5(18-10(12,13)14)1-2-8(6)17-9/h1-3H,4H2 |
| InChIKey | RRQZOTSVMCKZSU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.05 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|