C10H7Br2NO2 — CID 131306787
2-bromo-1-[5-(bromomethyl)-1,3-benzoxazol-2-yl]ethanone (PubChem CID 131306787) has the molecular formula C10H7Br2NO2 and a molecular weight of 332.98 g/mol. Its IUPAC name is 2-bromo-1-[5-(bromomethyl)-1,3-benzoxazol-2-yl]ethanone.
| Compound Name | 2-bromo-1-[5-(bromomethyl)-1,3-benzoxazol-2-yl]ethanone |
|---|---|
| PubChem CID | 131306787 |
| Molecular Formula | C10H7Br2NO2 |
| Molecular Weight | 332.98 g/mol |
| Exact Mass | 330.88 |
| IUPAC Name | 2-bromo-1-[5-(bromomethyl)-1,3-benzoxazol-2-yl]ethanone |
| SMILES | O=C(CBr)c1nc2cc(CBr)ccc2o1 |
| InChI | InChI=1S/C10H7Br2NO2/c11-4-6-1-2-9-7(3-6)13-10(15-9)8(14)5-12/h1-3H,4-5H2 |
| InChIKey | QVFROASDFHUFNU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.98 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|