C9H6ClNO3 — CID 130786897
5-(chloromethyl)-1,3-benzoxazole-2-carboxylic acid (PubChem CID 130786897) has the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-benzoxazole-2-carboxylic acid.
| Compound Name | 5-(chloromethyl)-1,3-benzoxazole-2-carboxylic acid |
|---|---|
| PubChem CID | 130786897 |
| Molecular Formula | C9H6ClNO3 |
| Molecular Weight | 211.60 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 5-(chloromethyl)-1,3-benzoxazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc2cc(CCl)ccc2o1 |
| InChI | InChI=1S/C9H6ClNO3/c10-4-5-1-2-7-6(3-5)11-8(14-7)9(12)13/h1-3H,4H2,(H,12,13) |
| InChIKey | JPPKMPYOIBDOTF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.60 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|