6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride

C9H5Cl2NO2 — CID 130792984

IUPAC6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride
SMILESO=C(Cl)c1nc2ccc(CCl)cc2o1
InChIInChI=1S/C9H5Cl2NO2/c10-4-5-1-2-6-7(3-5)14-9(12-6)8(11)13/h1-3H,4H2
InChIKeyXVZNOJCSLLQZFX-UHFFFAOYSA-N
MW230.05 g/mol
LogP2.95
Rot. Bonds2

About 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride

6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride (PubChem CID 130792984) has the molecular formula C9H5Cl2NO2 and a molecular weight of 230.05 g/mol. Its IUPAC name is 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride.

Molecular Properties

Compound Name6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride
PubChem CID130792984
Molecular FormulaC9H5Cl2NO2
Molecular Weight230.05 g/mol
Exact Mass228.97
IUPAC Name6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride
SMILESO=C(Cl)c1nc2ccc(CCl)cc2o1
InChIInChI=1S/C9H5Cl2NO2/c10-4-5-1-2-6-7(3-5)14-9(12-6)8(11)13/h1-3H,4H2
InChIKeyXVZNOJCSLLQZFX-UHFFFAOYSA-N
XLogP2.95
TPSA43.10 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.05
LogP ≤ 52.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride?
The IUPAC name of 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride (CID 130792984) is 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride.
What is the SMILES notation for 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride?
The canonical SMILES for 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride is O=C(Cl)c1nc2ccc(CCl)cc2o1.
What is the InChIKey of 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride?
The InChIKey is XVZNOJCSLLQZFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl2NO2/c10-4-5-1-2-6-7(3-5)14-9(12-6)8(11)13/h1-3H,4H2.
What are the key properties of 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride?
6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride has a molecular weight of 230.05 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride is sourced from PubChem (CID 130792984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).