C9H5Cl2NO2 — CID 130792984
6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride (PubChem CID 130792984) has the molecular formula C9H5Cl2NO2 and a molecular weight of 230.05 g/mol. Its IUPAC name is 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride.
| Compound Name | 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride |
|---|---|
| PubChem CID | 130792984 |
| Molecular Formula | C9H5Cl2NO2 |
| Molecular Weight | 230.05 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | 6-(chloromethyl)-1,3-benzoxazole-2-carbonyl chloride |
| SMILES | O=C(Cl)c1nc2ccc(CCl)cc2o1 |
| InChI | InChI=1S/C9H5Cl2NO2/c10-4-5-1-2-6-7(3-5)14-9(12-6)8(11)13/h1-3H,4H2 |
| InChIKey | XVZNOJCSLLQZFX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.05 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|