C15H8N2O5 — CID 174634170
bis(6-hydroxy-1,3-benzoxazol-2-yl)methanone (PubChem CID 174634170) has the molecular formula C15H8N2O5 and a molecular weight of 296.24 g/mol. Its IUPAC name is bis(6-hydroxy-1,3-benzoxazol-2-yl)methanone.
| Compound Name | bis(6-hydroxy-1,3-benzoxazol-2-yl)methanone |
|---|---|
| PubChem CID | 174634170 |
| Molecular Formula | C15H8N2O5 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | bis(6-hydroxy-1,3-benzoxazol-2-yl)methanone |
| SMILES | O=C(c1nc2ccc(O)cc2o1)c1nc2ccc(O)cc2o1 |
| InChI | InChI=1S/C15H8N2O5/c18-7-1-3-9-11(5-7)21-14(16-9)13(20)15-17-10-4-2-8(19)6-12(10)22-15/h1-6,18-19H |
| InChIKey | OCPXVGCWYHVHAS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |