C13H13NO2 — CID 91417035
2-hexa-2,4-dien-3-yl-1,3-benzoxazol-6-ol (PubChem CID 91417035) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-hexa-2,4-dien-3-yl-1,3-benzoxazol-6-ol.
| Compound Name | 2-hexa-2,4-dien-3-yl-1,3-benzoxazol-6-ol |
|---|---|
| PubChem CID | 91417035 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-hexa-2,4-dien-3-yl-1,3-benzoxazol-6-ol |
| SMILES | CC=CC(=CC)c1nc2ccc(O)cc2o1 |
| InChI | InChI=1S/C13H13NO2/c1-3-5-9(4-2)13-14-11-7-6-10(15)8-12(11)16-13/h3-8,15H,1-2H3 |
| InChIKey | NAZHLMLIAKVXTQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|