C16H15NO3 — CID 129309307
methyl 2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,3-benzoxazole-5-carboxylate (PubChem CID 129309307) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,3-benzoxazole-5-carboxylate.
| Compound Name | methyl 2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 129309307 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | methyl 2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-1,3-benzoxazole-5-carboxylate |
| SMILES | C=C/C=C\C(=C/C)c1nc2cc(C(=O)OC)ccc2o1 |
| InChI | InChI=1S/C16H15NO3/c1-4-6-7-11(5-2)15-17-13-10-12(16(18)19-3)8-9-14(13)20-15/h4-10H,1H2,2-3H3/b7-6-,11-5+ |
| InChIKey | GLWXSGGBSPQPOB-TUKAJDRUSA-N |
| XLogP | 3.76 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|