C13H11F2NO3S — CID 19384301
methyl 2-(4,4-difluorobut-3-enylsulfanyl)-1,3-benzoxazole-5-carboxylate (PubChem CID 19384301) has the molecular formula C13H11F2NO3S and a molecular weight of 299.30 g/mol. Its IUPAC name is methyl 2-(4,4-difluorobut-3-enylsulfanyl)-1,3-benzoxazole-5-carboxylate.
| Compound Name | methyl 2-(4,4-difluorobut-3-enylsulfanyl)-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 19384301 |
| Molecular Formula | C13H11F2NO3S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | methyl 2-(4,4-difluorobut-3-enylsulfanyl)-1,3-benzoxazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2oc(SCCC=C(F)F)nc2c1 |
| InChI | InChI=1S/C13H11F2NO3S/c1-18-12(17)8-4-5-10-9(7-8)16-13(19-10)20-6-2-3-11(14)15/h3-5,7H,2,6H2,1H3 |
| InChIKey | DBGRGWNNUOTAIL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|