C12H11F2NO2S — CID 19384250
2-(4,4-difluorobut-3-enylsulfanyl)-4-methoxy-1,3-benzoxazole (PubChem CID 19384250) has the molecular formula C12H11F2NO2S and a molecular weight of 271.29 g/mol. Its IUPAC name is 2-(4,4-difluorobut-3-enylsulfanyl)-4-methoxy-1,3-benzoxazole.
| Compound Name | 2-(4,4-difluorobut-3-enylsulfanyl)-4-methoxy-1,3-benzoxazole |
|---|---|
| PubChem CID | 19384250 |
| Molecular Formula | C12H11F2NO2S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 2-(4,4-difluorobut-3-enylsulfanyl)-4-methoxy-1,3-benzoxazole |
| SMILES | COc1cccc2oc(SCCC=C(F)F)nc12 |
| InChI | InChI=1S/C12H11F2NO2S/c1-16-8-4-2-5-9-11(8)15-12(17-9)18-7-3-6-10(13)14/h2,4-6H,3,7H2,1H3 |
| InChIKey | BMANXIFOMXFXOK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|