C11H8F2N2O3S — CID 19384274
2-(4,4-difluorobut-3-enylsulfanyl)-4-nitro-1,3-benzoxazole (PubChem CID 19384274) has the molecular formula C11H8F2N2O3S and a molecular weight of 286.26 g/mol. Its IUPAC name is 2-(4,4-difluorobut-3-enylsulfanyl)-4-nitro-1,3-benzoxazole.
| Compound Name | 2-(4,4-difluorobut-3-enylsulfanyl)-4-nitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 19384274 |
| Molecular Formula | C11H8F2N2O3S |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-(4,4-difluorobut-3-enylsulfanyl)-4-nitro-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1cccc2oc(SCCC=C(F)F)nc12 |
| InChI | InChI=1S/C11H8F2N2O3S/c12-9(13)5-2-6-19-11-14-10-7(15(16)17)3-1-4-8(10)18-11/h1,3-5H,2,6H2 |
| InChIKey | BTAXGOLOSPOVLR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|