C12H14N4O4 — CID 106277834
2,2-dimethyl-3-[(4-nitro-1,3-benzoxazol-2-yl)amino]propanamide (PubChem CID 106277834) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(4-nitro-1,3-benzoxazol-2-yl)amino]propanamide.
| Compound Name | 2,2-dimethyl-3-[(4-nitro-1,3-benzoxazol-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 106277834 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2,2-dimethyl-3-[(4-nitro-1,3-benzoxazol-2-yl)amino]propanamide |
| SMILES | CC(C)(CNc1nc2c([N+](=O)[O-])cccc2o1)C(N)=O |
| InChI | InChI=1S/C12H14N4O4/c1-12(2,10(13)17)6-14-11-15-9-7(16(18)19)4-3-5-8(9)20-11/h3-5H,6H2,1-2H3,(H2,13,17)(H,14,15) |
| InChIKey | ULCCKCLUTJLGGS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|