C13H17N3O3 — CID 79883549
N-hexyl-4-nitro-1,3-benzoxazol-2-amine (PubChem CID 79883549) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-hexyl-4-nitro-1,3-benzoxazol-2-amine.
| Compound Name | N-hexyl-4-nitro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 79883549 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-hexyl-4-nitro-1,3-benzoxazol-2-amine |
| SMILES | CCCCCCNc1nc2c([N+](=O)[O-])cccc2o1 |
| InChI | InChI=1S/C13H17N3O3/c1-2-3-4-5-9-14-13-15-12-10(16(17)18)7-6-8-11(12)19-13/h6-8H,2-5,9H2,1H3,(H,14,15) |
| InChIKey | LAPIJUSFMRTLNA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|