C14H19N3O4 — CID 79884431
N-[2-(3-methylbutoxy)ethyl]-4-nitro-1,3-benzoxazol-2-amine (PubChem CID 79884431) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is N-[2-(3-methylbutoxy)ethyl]-4-nitro-1,3-benzoxazol-2-amine.
| Compound Name | N-[2-(3-methylbutoxy)ethyl]-4-nitro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 79884431 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-[2-(3-methylbutoxy)ethyl]-4-nitro-1,3-benzoxazol-2-amine |
| SMILES | CC(C)CCOCCNc1nc2c([N+](=O)[O-])cccc2o1 |
| InChI | InChI=1S/C14H19N3O4/c1-10(2)6-8-20-9-7-15-14-16-13-11(17(18)19)4-3-5-12(13)21-14/h3-5,10H,6-9H2,1-2H3,(H,15,16) |
| InChIKey | BCUWSNPDHUBXEP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|