C11H10N6O3 — CID 79882095
4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1,3-benzoxazol-2-amine (PubChem CID 79882095) has the molecular formula C11H10N6O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is 4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1,3-benzoxazol-2-amine.
| Compound Name | 4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 79882095 |
| Molecular Formula | C11H10N6O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]-1,3-benzoxazol-2-amine |
| SMILES | O=[N+]([O-])c1cccc2oc(NCCc3ncn[nH]3)nc12 |
| InChI | InChI=1S/C11H10N6O3/c18-17(19)7-2-1-3-8-10(7)15-11(20-8)12-5-4-9-13-6-14-16-9/h1-3,6H,4-5H2,(H,12,15)(H,13,14,16) |
| InChIKey | FPQFNQKXBNBAAS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|