C10H7N5O4 — CID 106403200
4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-benzoxazol-2-amine (PubChem CID 106403200) has the molecular formula C10H7N5O4 and a molecular weight of 261.20 g/mol. Its IUPAC name is 4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-benzoxazol-2-amine.
| Compound Name | 4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 106403200 |
| Molecular Formula | C10H7N5O4 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 4-nitro-N-(1,2,4-oxadiazol-3-ylmethyl)-1,3-benzoxazol-2-amine |
| SMILES | O=[N+]([O-])c1cccc2oc(NCc3ncon3)nc12 |
| InChI | InChI=1S/C10H7N5O4/c16-15(17)6-2-1-3-7-9(6)13-10(19-7)11-4-8-12-5-18-14-8/h1-3,5H,4H2,(H,11,13) |
| InChIKey | VBRIQMPZWOMPHF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|