C9H9N3O3 — CID 79881998
N-ethyl-4-nitro-1,3-benzoxazol-2-amine (PubChem CID 79881998) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is N-ethyl-4-nitro-1,3-benzoxazol-2-amine.
| Compound Name | N-ethyl-4-nitro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 79881998 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | N-ethyl-4-nitro-1,3-benzoxazol-2-amine |
| SMILES | CCNc1nc2c([N+](=O)[O-])cccc2o1 |
| InChI | InChI=1S/C9H9N3O3/c1-2-10-9-11-8-6(12(13)14)4-3-5-7(8)15-9/h3-5H,2H2,1H3,(H,10,11) |
| InChIKey | AGIQLLJWGKGDKZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|