C12H14N4O3 — CID 79882409
4-nitro-N-(pyrrolidin-2-ylmethyl)-1,3-benzoxazol-2-amine (PubChem CID 79882409) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 4-nitro-N-(pyrrolidin-2-ylmethyl)-1,3-benzoxazol-2-amine.
| Compound Name | 4-nitro-N-(pyrrolidin-2-ylmethyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 79882409 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-nitro-N-(pyrrolidin-2-ylmethyl)-1,3-benzoxazol-2-amine |
| SMILES | O=[N+]([O-])c1cccc2oc(NCC3CCCN3)nc12 |
| InChI | InChI=1S/C12H14N4O3/c17-16(18)9-4-1-5-10-11(9)15-12(19-10)14-7-8-3-2-6-13-8/h1,4-5,8,13H,2-3,6-7H2,(H,14,15) |
| InChIKey | KFQUSEZMEQWRLI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|