C12H16N4O3 — CID 79881769
2-N-(4-nitro-1,3-benzoxazol-2-yl)pentane-1,2-diamine (PubChem CID 79881769) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-N-(4-nitro-1,3-benzoxazol-2-yl)pentane-1,2-diamine.
| Compound Name | 2-N-(4-nitro-1,3-benzoxazol-2-yl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 79881769 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-N-(4-nitro-1,3-benzoxazol-2-yl)pentane-1,2-diamine |
| SMILES | CCCC(CN)Nc1nc2c([N+](=O)[O-])cccc2o1 |
| InChI | InChI=1S/C12H16N4O3/c1-2-4-8(7-13)14-12-15-11-9(16(17)18)5-3-6-10(11)19-12/h3,5-6,8H,2,4,7,13H2,1H3,(H,14,15) |
| InChIKey | BUTMJGGCRSBLSB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|