About 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine
2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine (PubChem CID 79890155) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine.
Molecular Properties
| Compound Name | 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine |
| PubChem CID | 79890155 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine |
| SMILES | CCC(CC)Nc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C12H17N3O/c1-3-8(4-2)14-12-15-11-9(13)6-5-7-10(11)16-12/h5-8H,3-4,13H2,1-2H3,(H,14,15) |
| InChIKey | QLGHPUZNTCBKFB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine?
The IUPAC name of 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine (CID 79890155) is 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine.
What is the SMILES notation for 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine?
The canonical SMILES for 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine is CCC(CC)Nc1nc2c(N)cccc2o1.
What is the InChIKey of 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine?
The InChIKey is QLGHPUZNTCBKFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c1-3-8(4-2)14-12-15-11-9(13)6-5-7-10(11)16-12/h5-8H,3-4,13H2,1-2H3,(H,14,15).
What are the key properties of 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine?
2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine has a molecular weight of 219.29 g/mol, XLogP of 3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine is sourced from PubChem (CID 79890155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).