C12H17N3O — CID 79890155
2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine (PubChem CID 79890155) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine.
| Compound Name | 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine |
|---|---|
| PubChem CID | 79890155 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-N-pentan-3-yl-1,3-benzoxazole-2,4-diamine |
| SMILES | CCC(CC)Nc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C12H17N3O/c1-3-8(4-2)14-12-15-11-9(13)6-5-7-10(11)16-12/h5-8H,3-4,13H2,1-2H3,(H,14,15) |
| InChIKey | QLGHPUZNTCBKFB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|