C12H17N3O2 — CID 104758666
2-N-(2-propan-2-yloxyethyl)-1,3-benzoxazole-2,4-diamine (PubChem CID 104758666) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-N-(2-propan-2-yloxyethyl)-1,3-benzoxazole-2,4-diamine.
| Compound Name | 2-N-(2-propan-2-yloxyethyl)-1,3-benzoxazole-2,4-diamine |
|---|---|
| PubChem CID | 104758666 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 2-N-(2-propan-2-yloxyethyl)-1,3-benzoxazole-2,4-diamine |
| SMILES | CC(C)OCCNc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C12H17N3O2/c1-8(2)16-7-6-14-12-15-11-9(13)4-3-5-10(11)17-12/h3-5,8H,6-7,13H2,1-2H3,(H,14,15) |
| InChIKey | WSSBAALTQFZJJI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|