C10H10N4O4 — CID 79881441
2-[(4-nitro-1,3-benzoxazol-2-yl)amino]propanamide (PubChem CID 79881441) has the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. Its IUPAC name is 2-[(4-nitro-1,3-benzoxazol-2-yl)amino]propanamide.
| Compound Name | 2-[(4-nitro-1,3-benzoxazol-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 79881441 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-[(4-nitro-1,3-benzoxazol-2-yl)amino]propanamide |
| SMILES | CC(Nc1nc2c([N+](=O)[O-])cccc2o1)C(N)=O |
| InChI | InChI=1S/C10H10N4O4/c1-5(9(11)15)12-10-13-8-6(14(16)17)3-2-4-7(8)18-10/h2-5H,1H3,(H2,11,15)(H,12,13) |
| InChIKey | BELHVTUEHWEUKI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|