C10H8N2O5 — CID 83859232
2-(4-nitro-1,3-benzoxazol-2-yl)propanoic acid (PubChem CID 83859232) has the molecular formula C10H8N2O5 and a molecular weight of 236.18 g/mol. Its IUPAC name is 2-(4-nitro-1,3-benzoxazol-2-yl)propanoic acid.
| Compound Name | 2-(4-nitro-1,3-benzoxazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 83859232 |
| Molecular Formula | C10H8N2O5 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-(4-nitro-1,3-benzoxazol-2-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1nc2c([N+](=O)[O-])cccc2o1 |
| InChI | InChI=1S/C10H8N2O5/c1-5(10(13)14)9-11-8-6(12(15)16)3-2-4-7(8)17-9/h2-5H,1H3,(H,13,14) |
| InChIKey | POOHXIMMWBALCW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 106.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|