C11H9NO6 — CID 138472648
2-(4-methoxy-1,3-benzoxazol-2-yl)propanedioic acid (PubChem CID 138472648) has the molecular formula C11H9NO6 and a molecular weight of 251.19 g/mol. Its IUPAC name is 2-(4-methoxy-1,3-benzoxazol-2-yl)propanedioic acid.
| Compound Name | 2-(4-methoxy-1,3-benzoxazol-2-yl)propanedioic acid |
|---|---|
| PubChem CID | 138472648 |
| Molecular Formula | C11H9NO6 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-(4-methoxy-1,3-benzoxazol-2-yl)propanedioic acid |
| SMILES | COc1cccc2oc(C(C(=O)O)C(=O)O)nc12 |
| InChI | InChI=1S/C11H9NO6/c1-17-5-3-2-4-6-8(5)12-9(18-6)7(10(13)14)11(15)16/h2-4,7H,1H3,(H,13,14)(H,15,16) |
| InChIKey | DTWWRAFMBPZPLH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|