C15H19NO4 — CID 114764820
2-ethyl-2-[(4-methoxy-1,3-benzoxazol-2-yl)methyl]butanoic acid (PubChem CID 114764820) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-ethyl-2-[(4-methoxy-1,3-benzoxazol-2-yl)methyl]butanoic acid.
| Compound Name | 2-ethyl-2-[(4-methoxy-1,3-benzoxazol-2-yl)methyl]butanoic acid |
|---|---|
| PubChem CID | 114764820 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-ethyl-2-[(4-methoxy-1,3-benzoxazol-2-yl)methyl]butanoic acid |
| SMILES | CCC(CC)(Cc1nc2c(OC)cccc2o1)C(=O)O |
| InChI | InChI=1S/C15H19NO4/c1-4-15(5-2,14(17)18)9-12-16-13-10(19-3)7-6-8-11(13)20-12/h6-8H,4-5,9H2,1-3H3,(H,17,18) |
| InChIKey | XPQNJSCGWDXCNX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |