C12H16N2O2 — CID 114764864
4-(4-methoxy-1,3-benzoxazol-2-yl)butan-1-amine (PubChem CID 114764864) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 4-(4-methoxy-1,3-benzoxazol-2-yl)butan-1-amine.
| Compound Name | 4-(4-methoxy-1,3-benzoxazol-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 114764864 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 4-(4-methoxy-1,3-benzoxazol-2-yl)butan-1-amine |
| SMILES | COc1cccc2oc(CCCCN)nc12 |
| InChI | InChI=1S/C12H16N2O2/c1-15-9-5-4-6-10-12(9)14-11(16-10)7-2-3-8-13/h4-6H,2-3,7-8,13H2,1H3 |
| InChIKey | PDWVYTPOOOXNFU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|