C13H18N2O2 — CID 114764980
2-(4-methoxy-1,3-benzoxazol-2-yl)pentan-2-amine (PubChem CID 114764980) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-(4-methoxy-1,3-benzoxazol-2-yl)pentan-2-amine.
| Compound Name | 2-(4-methoxy-1,3-benzoxazol-2-yl)pentan-2-amine |
|---|---|
| PubChem CID | 114764980 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-(4-methoxy-1,3-benzoxazol-2-yl)pentan-2-amine |
| SMILES | CCCC(C)(N)c1nc2c(OC)cccc2o1 |
| InChI | InChI=1S/C13H18N2O2/c1-4-8-13(2,14)12-15-11-9(16-3)6-5-7-10(11)17-12/h5-7H,4,8,14H2,1-3H3 |
| InChIKey | PRMGTVJSXWXOHK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |